

Informazioni sul prodotto
Nome:(S)-(-)-2-Chloropropionic acid
Sinonimi:
- L-(a)-Chloropropionic acid(2S)-2-Chloropropanoic acid
Marchio:Biosynth
Descrizione:(S)-(-)-2-Chloropropionic acid is a biologically active molecule that can be used for the treatment of various diseases. It inhibits the production of voltage-dependent calcium channels, which are involved in the release of neurotransmitters and in locomotor activity. The inhibition of these channels leads to an increase in intracellular calcium levels and necrotic cell death. (S)-(-)-2-Chloropropionic acid has been shown to inhibit glutamate receptors, which are involved in the transmission of pain signals to the brain. This drug also binds to acid complexes, inhibiting their effects on cells and potentially leading to cancer cell death.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:108.52 g/mol
Formula:C3H5ClO2
Purezza:Min. 95%
Colore/Forma:Colourless To Pale Yellow Liquid