Informazioni sul prodotto
Nome:2-Chlorohydroquinone
Marchio:Biosynth
Descrizione:2-Chlorohydroquinone is a chemical compound with the molecular formula C6H4Cl2O2. It has been shown to be an effective biocidal agent for wastewater treatment and surface decontamination. 2-Chlorohydroquinone reacts with nitrite ions, forming chloroamines that react with organic compounds in the water, such as triclosan, leading to their oxidation. 2-Chlorohydroquinone is also a useful reagent for the synthesis of ethylene diamine, which is used in the manufacture of dyes and other chemicals.
2-Chlorohydroquinone has a redox potential of +0.19V, making it more reactive than hydrogen peroxide or sodium hypochlorite at neutral pH. The chemical is not very soluble in water and can be dissolved by adding a base such as ammonia or amines.
2-Chlorohydroquinone has a redox potential of +0.19V, making it more reactive than hydrogen peroxide or sodium hypochlorite at neutral pH. The chemical is not very soluble in water and can be dissolved by adding a base such as ammonia or amines.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:144.56 g/mol
Formula:C6H5ClO2
Purezza:Min. 95%
InChI:InChI=1S/C6H5ClO2/c7-5-3-4(8)1-2-6(5)9/h1-3,8-9H
InChI key:InChIKey=AJPXTSMULZANCB-UHFFFAOYSA-N
SMILES:Oc1ccc(O)c(Cl)c1