Informazioni sul prodotto
Nome:4-Chlorophenyl cyclopropyl ketone
Marchio:Biosynth
Descrizione:4-Chlorophenyl cyclopropyl ketone is an organic solvent that is used to synthesize a variety of organic compounds. It can be used as a Grignard reagent, which is a chemical reaction between magnesium and an alkyl halide. 4-Chlorophenyl cyclopropyl ketone has been shown to react with chloride to produce chlorobenzene and acetonitrile in the presence of an organic solvent such as tetrahydrofuran or solvents such as acetic acid or methanol. This synthesis yields high yields of product and requires less time for the reaction to occur than other methods, making it a favorable method for industrial use.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:180.63 g/mol
Formula:C10H9ClO
Purezza:Min. 95%
InChI:InChI=1S/C10H9ClO/c11-9-5-3-8(4-6-9)10(12)7-1-2-7/h3-7H,1-2H2
InChI key:InChIKey=OPSFCTBBDIDFJM-UHFFFAOYSA-N
SMILES:O=C(c1ccc(Cl)cc1)C1CC1