Informazioni sul prodotto
Nome:Cyclohexanesulfonyl chloride
Sinonimi:
- Cyclohexylsulfonyl chloride
Marchio:Biosynth
Descrizione:Cyclohexanesulfonyl chloride (CHSC) is an enzyme inhibitor that prevents the formation of fatty acid by inhibiting the enzyme delta-9-desaturase. CHSC has been shown to react with chloride ions in the liver and cause hepatitis, a condition characterized by inflammation of the liver. CHSC has been used as a radiation sensitizer in cancer therapy and is also used for treatment of metabolic disorders such as obesity and diabetes. Cyclohexanesulfonyl chloride binds to cannabinoid receptors, cb1 and cb2, with high affinity and can activate them. The activation of these receptors leads to hyperproliferative diseases such as cancer. CHSC reacts with hydrochloric acid to produce hydrogen sulfide gas, which causes high affinity binding at cb1 receptor sites.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:182.67 g/mol
Formula:C6H11ClO2S
Purezza:Min. 95%
InChI:InChI=1S/C6H11ClO2S/c7-10(8,9)6-4-2-1-3-5-6/h6H,1-5H2
InChI key:InChIKey=MJWVCJUSRGLHFO-UHFFFAOYSA-N
SMILES:O=S(=O)(Cl)C1CCCCC1