

Informazioni sul prodotto
Nome:Chromone-3-carboxylic acid
Marchio:Biosynth
Descrizione:Chromone-3-carboxylic acid is a reactive molecule that has been shown to exhibit antimicrobial properties. The three-dimensional structure of this molecule was first determined by vibrational spectroscopy, which showed that the hydroxy group and carbonyl group are in a hydrogen bond. Computational methods were used to determine the mechanism of reaction for chromone-3-carboxylic acid. This method showed that the presence of chloride ions or carbon disulphide could lead to the formation of a reactive intermediate. Chromone-3-carboxylic acid's cytostatic effects have been shown in both bacteria and mammalian cells, where it inhibits protein synthesis and induces apoptosis. Active methylene groups on chromone-3-carboxylic acid have also been shown to react with thiols, forming thioethers, which can act as inhibitors of enzymes such as phosphatases.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:190.15 g/mol
Formula:C10H6O4
Purezza:Min. 95%
InChI:InChI=1S/C10H6O4/c11-9-6-3-1-2-4-8(6)14-5-7(9)10(12)13/h1-5H,(H,12,13)
InChI key:InChIKey=PCIITXGDSHXTSN-UHFFFAOYSA-N
SMILES:O=C(O)c1coc2ccccc2c1=O