Informazioni sul prodotto
Nome:Desyl chloride
Marchio:Biosynth
Descrizione:Desyl chloride is a chemical compound that reacts with fatty acids and amines to form products such as chloromethyl ketones. The most common use of desyl chloride is in the production of fatty acid esters, which are used for the manufacture of detergents, lubricants, and food additives. The reaction between desyl chloride and an amine produces a chloromethyl ketone. Desyl chloride also reacts with a hydroxyl group to form an acid chloride, which can be converted into various other compounds by reacting it with another molecule containing an alcohol or phenol. Radiation can create an oxygen-containing reactive site on the pyrazole ring in desyl chloride, which is responsible for its high reactivity toward amines. In human serum, desyl chloride produces a cross-coupling product through oxidative carbonylation.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:230.69 g/mol
Formula:C14H11ClO
Purezza:Min. 95%
Colore/Forma:Powder
InChI:InChI=1S/C14H11ClO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13H
InChI key:InChIKey=RXDYOLRABMJTEF-UHFFFAOYSA-N
SMILES:O=C(c1ccccc1)C(Cl)c1ccccc1