Informazioni sul prodotto
Nome:1,1-Dichloro-2-phenylcyclopropane
Marchio:Biosynth
Descrizione:Dichlorocarbene is a chemical compound that is a colorless gas with a pungent odor. It has been used in the laboratory to synthesize other organic molecules, such as styrene. Dichlorocarbene is one of the simplest and most reactive chlorocarbons. It has been shown to be an electron-deficient molecule, which can be explained by its constant molecular geometry and electron distribution around the central carbon atom. Experimental evidence shows that dichlorocarbene reacts with polyatomic molecules, such as CO2, N2O5, and HNO3, to form covalent bonds. Dichlorocarbene is also known for its use in curing plant diseases caused by bacteria or fungi. Covid-19 was designed to combat pandemic influenza; it contains dichlorocarbene as an active ingredient.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:187.07 g/mol
Formula:C9H8Cl2
Purezza:Min. 95%
InChI:InChI=1S/C9H8Cl2/c10-9(11)6-8(9)7-4-2-1-3-5-7/h1-5,8H,6H2
InChI key:InChIKey=WLWFQGXZIDYWQF-UHFFFAOYSA-N
SMILES:ClC1(Cl)CC1c1ccccc1