Informazioni sul prodotto
Nome:Dibenzyl dicarbonate
Marchio:Biosynth
Descrizione:Dibenzyl dicarbonate is a β-amino acid that is an effective substrate for the asymmetric synthesis of α-amino acids. It can be catalyzed by modifiers such as chloride and sodium carbonate. The reaction mechanism involves the formation of a reactive enolate anion, which reacts with hydroxyl groups to form an acyloxy intermediate. This intermediate then undergoes transfer reactions to form the desired product. Dibenzyl dicarbonate is used as an inhibitor in cardiac research and has been shown to have potent inhibitory activity against cardiac muscle cells. Dibenzyl dicarbonate is also used in the synthesis of heterocycles with a hydroxyl group such as huperzia serrata, which is used in traditional Chinese medicine for treatment of heart disease.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:286.28 g/mol
Formula:C16H14O5
Purezza:Min. 95%
Colore/Forma:Off-White To Light (Or Pale) Yellow Solid
InChI:InChI=1S/C16H14O5/c17-15(19-11-13-7-3-1-4-8-13)21-16(18)20-12-14-9-5-2-6-10-14/h1-10H,11-12H2
InChI key:InChIKey=FHRRJZZGSJXPRQ-UHFFFAOYSA-N
SMILES:O=C(OCc1ccccc1)OC(=O)OCc1ccccc1