

Informazioni sul prodotto
Nome:2,3-Dichlorophenol
Marchio:Biosynth
Descrizione:2,3-Dichlorophenol is a chemical compound with the molecular formula C6H2Cl2O. It is used as a raw material for the production of 2,4-dichlorophenoxyacetic acid (2,4-D), which is a common herbicide. In addition to its use in the manufacture of herbicides, 2,3-Dichlorophenol can be used to produce other chemicals such as phenol and chloroform. The molecule has two chlorine atoms bonded to an aromatic ring made up of six carbon atoms and one oxygen atom. The two chlorine atoms are located on opposite sides of the aromatic ring so they are not next to each other. This configuration makes it more difficult for 2,3-Dichlorophenol to react with other molecules than if it had only one chlorine atom on either side of the aromatic ring. It has been shown that 2,3-Dichlorophenol reacts with water molecules through hydrogen
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:163 g/mol
Formula:C6H4Cl2O
Purezza:Min. 95%
InChI:InChI=1S/C6H4Cl2O/c7-4-2-1-3-5(9)6(4)8/h1-3,9H
InChI key:InChIKey=UMPSXRYVXUPCOS-UHFFFAOYSA-N
SMILES:Oc1cccc(Cl)c1Cl