

Informazioni sul prodotto
Nome:a, a-Dimethyl 3-isopropenylbenzyl isocyanate
Marchio:Biosynth
Descrizione:3-Isopropenylbenzyl isocyanate is a functional monomer that is used in the polymerization process. It reacts with styrene to form polymers and has reactive groups that can be used for cross-linking. 3-Isopropenylbenzyl isocyanate has a primary amino group and an aliphatic chain of 3 carbon atoms, which can be reacted with other molecules to form new compounds. The compound exists as a colorless liquid at room temperature and has a crystallization process that involves radiation or peroxide. This chemical can also be used as an additive for size-exclusion chromatography to increase the resolution of small molecules.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:201.26 g/mol
Formula:C13H15NO
Purezza:Min. 95%
InChI:InChI=1S/C13H15NO/c1-10(2)11-6-5-7-12(8-11)13(3,4)14-9-15/h5-8H,1H2,2-4H3
InChI key:InChIKey=ZVEMLYIXBCTVOF-UHFFFAOYSA-N
SMILES:C=C(C)c1cccc(C(C)(C)N=C=O)c1