Informazioni sul prodotto
Nome:Dibenzyl diselenide
Marchio:Biosynth
Descrizione:Dibenzyl diselenide is a compound that inhibits the growth of cancer cells. It binds to the selenium compound, which is an enzyme that is involved in the formation of disulfide bonds. The inhibition of this enzyme prevents cancer cells from dividing, leading to cell death. Dibenzyl diselenide has been shown to have inhibitory properties against murine hepatoma cells and human liver cells in culture. The mechanism of action is not yet understood, but it may be due to light emission or through a reaction with palladium complexes. This drug also has pharmaceutical applications as it can be used for the treatment of degenerative diseases such as Parkinson's disease and Alzheimer's disease.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:340.18 g/mol
Formula:C14H14Se2
Purezza:Min. 95%
InChI:InChI=1S/C14H14Se2/c1-3-7-13(8-4-1)11-15-16-12-14-9-5-2-6-10-14/h1-10H,11-12H2
InChI key:InChIKey=HYAVEDMFTNAZQE-UHFFFAOYSA-N
SMILES:c1ccc(C[Se][Se]Cc2ccccc2)cc1