Informazioni sul prodotto
Nome:2,7-Dibromopyrene
Marchio:Biosynth
Descrizione:2,7-Dibromopyrene is a fluorescent aromatic hydrocarbon with a bromine atom in the 2 and 7 positions. It has a light emission maximum at around 440 nm. This compound has been used as a fluorescence resonance energy transfer (FRET) probe to measure distances between biomolecules such as DNA, RNA, proteins, and lipids. It also has optical properties that can be altered by substitution of the carbonyl group with an alkynyl group or nitro group. 2,7-Dibromopyrene reacts with electron donors such as alcohols to form alkylthio groups and with electron acceptors such as halogens to form halogenated products. The reaction mechanism involves the formation of an organometallic intermediate.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:360.04 g/mol
Formula:C16H8Br2
Purezza:Min. 95%
InChI:InChI=1S/C16H8Br2/c17-13-5-9-1-2-10-6-14(18)8-12-4-3-11(7-13)15(9)16(10)12/h1-8H
InChI key:InChIKey=IGTQPXMEWQTTBJ-UHFFFAOYSA-N
SMILES:Brc1cc2ccc3cc(Br)cc4ccc(c1)c2c34