Informazioni sul prodotto
Nome:Diethyl sebacate
Sinonimi:
- Decanedioic Acid Diethyl EsterSebacic Acid Diethyl Ester
Marchio:Biosynth
Descrizione:Diethyl sebacate is an antimicrobial peptide that belongs to the group of fatty acids. It has a hydroxyl group and a carboxylic acid group in its molecule. Diethyl sebacate inhibits the growth of bacteria by interfering with their cell membranes, which can lead to leakage of cellular contents. This prevents the transport of nutrients into the cells, which eventually leads to cell death. The fatty acid diethyl sebacate has shown chemical stability at room temperature and physiological functions such as absorption enhancement when used as an excipient. It also has properties that make it useful as a film-forming polymer or an absorption enhancer for poorly soluble drugs.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:258.35 g/mol
Formula:C14H26O4
Purezza:Min. 95%
InChI:InChI=1S/C14H26O4/c1-3-17-13(15)11-9-7-5-6-8-10-12-14(16)18-4-2/h3-12H2,1-2H3
InChI key:InChIKey=ONKUXPIBXRRIDU-UHFFFAOYSA-N
SMILES:CCOC(=O)CCCCCCCCC(=O)OCC