Informazioni sul prodotto
Nome:1,4-Difluoroanthraquinone
Marchio:Biosynth
Descrizione:1,4-Difluoroanthraquinone is a synthetic compound that has been shown to have anticancer activity. It can be used to treat cancer by inhibiting the growth of tumor cells. The compound has been shown to react with DNA in human ovarian carcinoma cells and inhibit RNA synthesis in human colon carcinoma cells. 1,4-Difluoroanthraquinone binds to the rRNA of the cancer cells and inhibits protein synthesis, leading to cell death by inhibition of protein synthesis. 1,4-Difluoroanthraquinone was synthesized using a tricycle reaction with alkylation and an asymmetric synthesis method. This process first involved an oxidative coupling reaction that led to the formation of an enol ether. This intermediate was then reacted with propiolic acid catalyzed by copper(II) chloride in ethanol at -78°C in order to yield the desired product.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:244.19 g/mol
Formula:C14H6F2O2
Purezza:Min. 95%
InChI:InChI=1S/C14H6F2O2/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-6H
InChI key:InChIKey=DTNCXQHDOJRTCD-UHFFFAOYSA-N
SMILES:O=C1c2ccccc2C(=O)c2c(F)ccc(F)c21