Informazioni sul prodotto
Nome:2-Ethylcyclopentanone
Sinonimi:
- cyclopentanone
- 2-ethyl-
Marchio:Biosynth
Descrizione:2-Ethylcyclopentanone is an alicyclic compound that has been identified as an unidentified component in a variety of different samples. 2-Ethylcyclopentanone can be extracted using solid phase microextraction and analyzed by gas chromatography-mass spectrometry. The techniques used for the identification of 2-ethylcyclopentanone are similar to those used to identify fatty acids and inorganic acid isomers. The technique used to identify 2-ethylcyclopentanone depends on whether it is being considered as a fatty acid, an inorganic acid, or another type of molecule. If 2-ethylcyclopentanone is being considered as a fatty acid, then the technique used would be gas chromatography with flame ionization detection (GC/FID). If it is being considered an inorganic acid, then the technique would be gas chromatography with electron capture detection (GC/ECD). Finally, if it is being considered another type of molecule, then
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:112.17 g/mol
Formula:C7H12O
Purezza:Min. 95%
InChI:InChI=1S/C7H12O/c1-2-6-4-3-5-7(6)8/h6H,2-5H2,1H3
InChI key:InChIKey=PPTKUTYPOKHBTL-UHFFFAOYSA-N
SMILES:CCC1CCCC1=O