Informazioni sul prodotto
Nome:2-Fluorophenol
Marchio:Biosynth
Descrizione:2-Fluorophenol is a compound that has the chemical formula C6H4F2O. It has a photoelectron with a kinetic energy of 8.0 eV, which is emitted when an electron in the molecule absorbs two photons of light with wavelengths of about 300 nm. 2-Fluorophenol is found in bacteria as an intermediate in the synthesis of diazonium salts and it also occurs naturally in wastewater as a byproduct of disinfection with chlorine or hydrochloric acid. 2-Fluorophenol can be synthesized by reacting phenol with hydrogen fluoride and sodium hydroxide. 2-Fluorophenol forms hydrogen bonds with other molecules and has intramolecular hydrogen bonding interactions between its own atoms. It also has steric interactions between its atoms, which are due to the fact that there is not enough space for all its atoms to fit into one molecule. 2-Fluorophenol reacts with hydrogen chloride
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:112.1 g/mol
Formula:C6H5FO
Purezza:Min. 95%
Colore/Forma:Colourless To Yellow To Brown Solid Or Liquid (May Vary)
InChI:InChI=1S/C6H5FO/c7-5-3-1-2-4-6(5)8/h1-4,8H
InChI key:InChIKey=HFHFGHLXUCOHLN-UHFFFAOYSA-N
SMILES:Oc1ccccc1F