

Informazioni sul prodotto
Nome:2-Fluorophenylacetic acid
Marchio:Biosynth
Descrizione:2-Fluorophenylacetic acid (2FPAA) is an organic compound that has been used as a reagent in analytical chemistry and organic synthesis. It is the methyl ester of 2-fluorophenol, which is synthesized by methylation of phenol with methanol and hydrochloric acid. The compound has two isomers, 2-fluoroanisole and 2-fluoroanisic acid. 2FPAA can be prepared by reacting trifluoroacetic acid with chloroform, or by reacting hydrochloric acid with phenol. This compound has been studied for its biological effects. It was found to have antiplatelet activity similar to prasugrel (a drug used to prevent blood clots), but less potent than other benzoxazinones such as fluoxetine.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:154.14 g/mol
Formula:C8H7FO2
Purezza:Min. 95%
InChI:InChI=1S/C8H7FO2/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4H,5H2,(H,10,11)
InChI key:InChIKey=RPTRFSADOICSSK-UHFFFAOYSA-N
SMILES:O=C(O)Cc1ccccc1F