Informazioni sul prodotto
Nome:Homophthalic acid
Marchio:Biosynth
Descrizione:Homophthalic acid is a non-toxic chemical compound that is used in the synthesis of various organic molecules. Homophthalic acid is synthesized by the Suzuki coupling reaction between malonic acid and aniline or benzyl chloride. Homophthalic acid can also be obtained from the reaction of hydrochloric acid and trifluoroacetic acid with a fatty acid. The asymmetric synthesis of homophthalic acid involves two different starting materials, one containing a hydroxyl group and the other containing a carboxylate group. The hydrogen bonding interactions between these groups are necessary for this synthesis to take place. Homophthalic acids have been found to bind to receptors in cell membranes and act as agonists, causing changes in receptor-mediated signal transduction pathways.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:180.16 g/mol
Formula:C9H8O4
Purezza:Min. 95%
InChI:InChI=1S/C9H8O4/c10-8(11)5-6-3-1-2-4-7(6)9(12)13/h1-4H,5H2,(H,10,11)(H,12,13)
InChI key:InChIKey=ZHQLTKAVLJKSKR-UHFFFAOYSA-N
SMILES:O=C(O)Cc1ccccc1C(=O)O