Informazioni sul prodotto
Nome:3-Hydroxy ropivacaine
Sinonimi:
- (2S)-N-(3-Hydroxy-2,6-dimethylphenyl)-1-propyl-2-piperidinecarboxamide
Marchio:Biosynth
Descrizione:3-Hydroxy ropivacaine is a local anesthetic that has been studied for its effects on the central nervous system and peripheral nerves. It is a prodrug that is metabolized to 3-hydroxypivalic acid (3HA) in the blood stream. 3-Hydroxy ropivacaine inhibits the metabolism of other drugs, such as phenytoin, which are metabolized by cytochrome P450, leading to increased concentrations of these drugs in plasma. 3-Hydroxy ropivacaine also inhibits the metabolism of other drugs, such as phenytoin, which are metabolized by cytochrome P450, leading to increased concentrations of these drugs in plasma. The inhibition study used reconstituted human plasma samples and chromatographic methods with reaction monitoring. The inhibition was observed at all three isozymes: CYP2C9, CYP2C19 and CYP3A4.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:290.4 g/mol
Formula:C17H26N2O2
Purezza:Min. 95%
InChI:InChI=1S/C17H26N2O2/c1-4-10-19-11-6-5-7-14(19)17(21)18-16-12(2)8-9-15(20)13(16)3/h8-9,14,20H,4-7,10-11H2,1-3H3,(H,18,21)
InChI key:InChIKey=IXOVDWXTIIYVOJ-UHFFFAOYSA-N
SMILES:CCCN1CCCCC1C(=O)Nc1c(C)ccc(O)c1C