Informazioni sul prodotto
Nome:2-Hydroxyisophthalaldehyde
Marchio:Biosynth
Descrizione:2-Hydroxyisophthalaldehyde is a molecule that is the product of imine formation. It has coordination geometry in which the nitrogen atom is chelated to two oxygen atoms and one proton. The molecule has an imine nitrogen atom and a chelate ring, which binds to metal ions such as copper or zinc. 2-Hydroxyisophthalaldehyde can be reduced by borohydride and exhibits tuberculostatic activity.
2-Hydroxyisophthalaldehyde can also be used to synthesize other molecules with interesting optical properties. It also has model system applications, as it is a tetranuclear compound.
2-Hydroxyisophthalaldehyde can also be used to synthesize other molecules with interesting optical properties. It also has model system applications, as it is a tetranuclear compound.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:150.13 g/mol
Formula:C8H6O3
Purezza:Min. 95%
InChI:InChI=1S/C8H6O3/c9-4-6-2-1-3-7(5-10)8(6)11/h1-5,11H
InChI key:InChIKey=JJOPQMAMJLOGFB-UHFFFAOYSA-N
SMILES:O=Cc1cccc(C=O)c1O