Informazioni sul prodotto
Nome:2-Isopropoxybenzoic acid
Marchio:Biosynth
Descrizione:2-Isopropoxybenzoic acid is an organic compound that is used as a reducing agent. It is an acid that has the ability to remove hydroxide ions from a solution. 2-Isopropoxybenzoic acid can be used in the preparation of carbanions, which are highly reactive chemical species containing C-O bonds. These compounds are useful for bond cleavage reactions, such as hydrolysis and oxidation. 2-Isopropoxybenzoic acid also reduces tyrosine kinase activity by acting as a competitive inhibitor, but does not inhibit other tyrosine protein kinases. This drug may also act as an aluminium chelator and reduce phosphonium salts to produce photoelectrons. The resulting electron transfer can react with salicylic acid and methyl alcohol to generate functional groups, such as esters or amides.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:180.2 g/mol
Formula:C10H12O3
Purezza:Min. 95%
InChI:InChI=1S/C10H12O3/c1-7(2)13-9-6-4-3-5-8(9)10(11)12/h3-7H,1-2H3,(H,11,12)
InChI key:InChIKey=WWPLDSOFBMZGIJ-UHFFFAOYSA-N
SMILES:CC(C)Oc1ccccc1C(=O)O