Informazioni sul prodotto
Nome:4-Isopropylphenol
Marchio:Biosynth
Descrizione:4-Isopropylphenol is a phenolic compound that can be found in food, cosmetics and pharmaceuticals. It is known for its ability to bind to the hydroxyl group of other molecules, which may result in hydrogen bonding interactions. 4-Isopropylphenol has been shown to have antifungal activity against Candida albicans and Saccharomyces cerevisiae. This may be due to its ability to react with the surface of these organisms and inhibit their growth by interfering with cellular respiration pathways. The reaction solution for 4-isopropylphenol contains activated carbon (C), hydrochloric acid (HCl), and proton (H). The kinetic rate equation for this reaction is:
4-Isopropylphenol + C --> C + 4-Isopropylphenol
where C represents activated carbon and H represents hydrochloric acid.
4-Isopropylphenol + C --> C + 4-Isopropylphenol
where C represents activated carbon and H represents hydrochloric acid.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:136.19 g/mol
Formula:C9H12O
Purezza:Min. 97.5%
InChI:InChI=1S/C9H12O/c1-7(2)8-3-5-9(10)6-4-8/h3-7,10H,1-2H3
InChI key:InChIKey=YQUQWHNMBPIWGK-UHFFFAOYSA-N
SMILES:CC(C)c1ccc(O)cc1