Informazioni sul prodotto
Nome:Isobutyl chloroformate
Marchio:Biosynth
Descrizione:Isobutyl chloroformate is a chemical compound that has intramolecular hydrogen and intermolecular hydrogen bonding. It is a colorless liquid with a boiling point of 182 °C. Isobutyl chloroformate reacts with the carboxylic acid group of caffeic acid to form the corresponding ester, which can be used in the synthesis of caproic acid. Isobutyl chloroformate has been shown to inhibit the growth of breast cancer cells (MDA-MB-231) by binding to integrin receptors on their surface. This drug also has anti-inflammatory properties, which may be due to its ability to inhibit bowel disease such as Crohn's disease and ulcerative colitis by blocking cyclooxygenase enzymes. The reaction mechanism for isobutyl chloroformate involves an S N 2 substitution reaction with formation of an intramolecular hydrogen bond and a disulfide bond. This compound also
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:136.58 g/mol
Formula:C5H9ClO2
Purezza:Min. 95%
InChI:InChI=1S/C5H9ClO2/c1-4(2)3-8-5(6)7/h4H,3H2,1-2H3
InChI key:InChIKey=YOETUEMZNOLGDB-UHFFFAOYSA-N
SMILES:CC(C)COC(=O)Cl