Informazioni sul prodotto
Nome:Isophthalic acid
Marchio:Biosynth
Descrizione:Isophthalic acid is a fatty acid that can be found in the form of a white solid. It has an intramolecular hydrogen bond between the nitrogen atom and the hydroxyl group. Isophthalic acid has been shown to undergo light emission when exposed to UV light. This chemical reaction is due to the presence of a p-hydroxybenzoic acid group. Isophthalic acid also participates in hydrogen bonding interactions with other molecules, such as methyl ethyl ketone, which are important for its stability and analytical properties. The kinetic data of isophthalic acid is not available because it does not react with oxygen or water vapor at room temperature.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:166.13 g/mol
Formula:C8H6O4
Purezza:Min. 95%
InChI:InChI=1S/C8H6O4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4H,(H,9,10)(H,11,12)
InChI key:InChIKey=QQVIHTHCMHWDBS-UHFFFAOYSA-N
SMILES:O=C(O)c1cccc(C(=O)O)c1