Informazioni sul prodotto
Nome:Isoastilbin
Marchio:Biosynth
Descrizione:Isoastilbin is a bioactive flavonoid, which is a naturally occurring compound found primarily in certain plant species, such as the Chinese herb Smilax glabra and Engelhardtia roxburghiana Wall leaf. As a derivative of astilbin, it possesses a unique mechanism that involves the modulation of cellular redox states. Isoastilbin's mode of action is primarily through its antioxidant properties, where it scavenges free radicals and thus, mitigates oxidative stress at a cellular level. Additionally, it exhibits anti-inflammatory effects by inhibiting the production of pro-inflammatory cytokines.The applications of Isoastilbin are diverse and promising in scientific research. It is extensively studied for its potential therapeutic benefits in combating diseases associated with oxidative stress and inflammation, such as cardiovascular diseases, neurodegenerative disorders, and certain metabolic syndromes. Furthermore, its role in cell signaling and apoptosis makes it a candidate for cancer research, offering insights into the molecular pathways that can be targeted for therapeutic intervention. Isoastilbin’s multifunctional properties make it a compelling subject for ongoing pharmacological and biomedical research.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:450.39 g/mol
Formula:C21H22O11
Purezza:Min. 95%
Colore/Forma:Powder
InChI:InChI=1S/C21H22O11/c1-7-15(26)17(28)18(29)21(30-7)32-20-16(27)14-12(25)5-9(22)6-13(14)31-19(20)8-2-3-10(23)11(24)4-8/h2-7,15,17-26,28-29H,1H3
InChI key:InChIKey=ZROGCCBNZBKLEL-UHFFFAOYSA-N
SMILES:CC1OC(OC2C(=O)c3c(O)cc(O)cc3OC2c2ccc(O)c(O)c2)C(O)C(O)C1O
Richiesta tecnica su: Isoastilbin
Si prega di utilizzare piuttosto il carrello per richiedere un preventivo o un ordine
Si prega di utilizzare piuttosto il carrello per richiedere un preventivo o un ordine. Se si desidera richiedere un preventivo o effettuare un ordine, si prega invece di aggiungere i prodotti desiderati al carrello e poi richiedere un preventivo o un ordine dal carrello. È più veloce, più economico, e potrà beneficiare degli sconti disponibili e di altri vantaggi.