Informazioni sul prodotto
Nome:Mucobromic acid
Sinonimi:
- (2Z)-2,3-Dibromo-4-oxobut-2-enoic acid2,3-Dibromomalealdehydic acid
Marchio:Biosynth
Descrizione:Mucobromic acid is a polycarboxylic acid that has an anti-inflammatory effect. It is used to treat inflammatory diseases, such as asthma and bronchitis, as well as other disorders caused by an overproduction of mucus. Mucobromic acid inhibits the production of mucus by binding to β-amino acids and neutralizing their acidic properties. Mucobromic acid reacts with ethylene diamine in a reaction mechanism that is similar to the reaction between histamine and its receptor. Mucobromic acid also has anti-inflammatory activity due to the inhibition of water vapor and hydrochloric acid production. This compound can be metabolized into hydrogen bond or subtilisin through oxidation, reduction, and hydrolysis reactions.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:257.86 g/mol
Formula:C4H2Br2O3
Purezza:Min. 95%
Colore/Forma:White To Beige To Light Brown Solid
InChI:InChI=1S/C4H2Br2O3/c5-2(1-7)3(6)4(8)9/h1H,(H,8,9)/b3-2-
InChI key:InChIKey=NCNYEGJDGNOYJX-IHWYPQMZSA-N
SMILES:O=C/C(Br)=C(/Br)C(=O)O