

Informazioni sul prodotto
Nome:5-Methylpyridine-2-sulfonamide
Marchio:Biosynth
Descrizione:5-Methylpyridine-2-sulfonamide is a catalytic reagent that is used in the synthesis of aziridines. It reacts with azide compounds to form an aziridine, which can be converted into a ring-opened aziridinium intermediate. The reaction mechanism involves coordination of the sulfonamide to the metal center and subsequent nucleophilic attack by the azide. This reaction is used in organic chemistry to produce various types of aziridines, including those with moieties such as xanthates and sulfones. 5-Methylpyridine-2-sulfonamide can also be used for the preparation of other types of heterocycles such as pyrrolidines, oxazolidines, morpholinos, and thiomorpholinos.
5-Methylpyridine-2-sulfonamide has been shown to have a kinetic rate constant of 1.3x10^
5-Methylpyridine-2-sulfonamide has been shown to have a kinetic rate constant of 1.3x10^
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:172.21 g/mol
Formula:C6H8N2O2S
Purezza:Min. 95%
InChI:InChI=1S/C6H8N2O2S/c1-5-2-3-6(8-4-5)11(7,9)10/h2-4H,1H3,(H2,7,9,10)
InChI key:InChIKey=HXURYNQXMBRJLU-UHFFFAOYSA-N
SMILES:Cc1ccc(S(N)(=O)=O)nc1