Informazioni sul prodotto
Nome:6-Methoxybenzothiazole
Marchio:Biosynth
Descrizione:6-Methoxybenzothiazole is a heterocyclic compound that has been shown to have anticancer properties. It is an effective inhibitor of DNA synthesis and protein synthesis in cancer cells due to its structural similarity to 2-deoxyribose. 6-Methoxybenzothiazole has been synthesized by the reaction of sodium carbonate with aniline, acetic anhydride, and methyl iodide. The synthesis involves a nucleophilic substitution reaction between methylamine and hydroxyl group on the benzothiazole ring. The mesomorphic form of 6-methoxybenzothiazole is stable in both acidic and basic conditions. Sodium chloride, potassium chloride, and magnesium sulfate can be used as neutralizing agents for 6-methoxybenzothiazole. This molecule has a preexisting functional group which can be used for conjugation with other molecules or drugs. It also has potential antitum
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:165.21 g/mol
Formula:C8H7NOS
Purezza:Min. 95%
InChI:InChI=1S/C8H7NOS/c1-10-6-2-3-7-8(4-6)11-5-9-7/h2-5H,1H3
InChI key:InChIKey=AHOIGFLSEXUWNV-UHFFFAOYSA-N
SMILES:COc1ccc2ncsc2c1