

Informazioni sul prodotto
Nome:2-Methylthiobenzoxazole
Marchio:Biosynth
Descrizione:2-Methylthiobenzoxazole is a molecule that has been studied for its potential use as a pesticide. It binds to the thiol group of cysteine residues in proteins and causes defoliation by inhibiting protein synthesis. The 2-methylthiobenzoxazole is also able to bind to other amino acid residues, such as cysteine, methionine, and histidine. This molecule has a high potency and can be used in solid form. The 2-methylthiobenzoxazole is not toxic to mammals because it quickly converts into an inactive form when exposed to air or light. This compound may have potential as a linker between two molecules with different properties, such as drug molecules and protein-binding molecules.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:165.21 g/mol
Formula:C8H7NOS
Purezza:Min. 95%
InChI:InChI=1S/C8H7NOS/c1-11-8-9-6-4-2-3-5-7(6)10-8/h2-5H,1H3
InChI key:InChIKey=CBXAWZGFEDZKFR-UHFFFAOYSA-N
SMILES:CSc1nc2ccccc2o1