Informazioni sul prodotto
Nome:N-Methyl-N-vinylacetamide
Sinonimi:
- N-Ethenyl-N-methyl-acetamide
Marchio:Biosynth
Descrizione:N-Methyl-N-vinylacetamide is a colorless liquid with a boiling point of 105.6°C. It is produced by the reaction of acetamide and vinyl chloride in the presence of hydrochloric acid, glycol ether, and methyl ethyl ketone. The viscosity of this compound is low, which makes it an ideal solvent for paints and coatings. N-Methyl-N-vinylacetamide also has genetic damaging effects and can cause mutations in bacteria that are exposed to this compound in high concentrations. This product has an unusual chemical structure due to its hydrogen bonding interactions.br>br>
br>br>
Hydrogen bonds are weak intermolecular forces between polar molecules, such as water or alcohols, that are formed by the attraction between a partially positive hydrogen atom on one molecule and the negative end of another nearby molecule. Hydrogen bonds stabilize certain molecular structures because they provide partial shielding from electrostatic interactions with
br>br>
Hydrogen bonds are weak intermolecular forces between polar molecules, such as water or alcohols, that are formed by the attraction between a partially positive hydrogen atom on one molecule and the negative end of another nearby molecule. Hydrogen bonds stabilize certain molecular structures because they provide partial shielding from electrostatic interactions with
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:99.13 g/mol
Formula:C5H9NO
Purezza:Min. 97.5%
Colore/Forma:Clear Liquid
InChI:InChI=1S/C5H9NO/c1-4-6(3)5(2)7/h4H,1H2,2-3H3
InChI key:InChIKey=PNLUGRYDUHRLOF-UHFFFAOYSA-N
SMILES:C=CN(C)C(C)=O
Richiesta tecnica su: N-Methyl-N-vinylacetamide
Si prega di utilizzare piuttosto il carrello per richiedere un preventivo o un ordine
Si prega di utilizzare piuttosto il carrello per richiedere un preventivo o un ordine. Se si desidera richiedere un preventivo o effettuare un ordine, si prega invece di aggiungere i prodotti desiderati al carrello e poi richiedere un preventivo o un ordine dal carrello. È più veloce, più economico, e potrà beneficiare degli sconti disponibili e di altri vantaggi.
