Informazioni sul prodotto
Nome:3-Mercapto-2-pentanone
Marchio:Biosynth
Descrizione:3-Mercapto-2-pentanone is a chemical compound that is found in the essential oil of cinnamon. 3-Mercapto-2-pentanone has been shown to be hydrolyzed by esterases, as well as thermally and chemically. The enzyme hydrolysis proceeds through a nucleophilic attack on the carbonyl group of 3-mercapto-2-pentanone. This reaction releases two products: butyric acid and an alcohol. The carbon source for this reaction is maltol, which can be used to measure the concentration of 3-mercapto-2-pentanone.
3 mercapto 2 pentanone also reacts with unlabeled sulfur dioxide to produce a model system for isotopomers. This model system was used to explain how isotopomers are formed during an enzymatic reaction with sulfur dioxide, which is labeled with deuterium at the methylene position. Carbon from
3 mercapto 2 pentanone also reacts with unlabeled sulfur dioxide to produce a model system for isotopomers. This model system was used to explain how isotopomers are formed during an enzymatic reaction with sulfur dioxide, which is labeled with deuterium at the methylene position. Carbon from
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:118.2 g/mol
Formula:C5H10OS
Purezza:Min. 95%
InChI:InChI=1S/C5H10OS/c1-3-5(7)4(2)6/h5,7H,3H2,1-2H3
InChI key:InChIKey=SZECUQRKLXRGSJ-UHFFFAOYSA-N
SMILES:CCC(S)C(C)=O