Informazioni sul prodotto
Nome:Methyl 4- vinybenzoate
Marchio:Biosynth
Descrizione:Methyl 4-vinylbenzoate is a monomer that is used in the production of polymers. It undergoes thermally induced polymerization to form a copolymer with styrene, which has a bulk density of 1.07 g/cm3. Methyl 4-vinylbenzoate can also be copolymerized with other monomers such as acrylonitrile and vinyl acetate, but this reaction may generate byproducts such as anthracene. The UV irradiation of methyl 4-vinylbenzoate leads to the formation of benzoates from the benzylic hydrogen atom, which are then polymerized to form polyvinylbenzene dendrons. Decarboxylation leads to the formation of radical coupling amines that can be used in organic synthesis reactions.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:162.19 g/mol
Formula:C10H10O2
Purezza:Min. 95%
InChI:InChI=1S/C10H10O2/c1-3-8-4-6-9(7-5-8)10(11)12-2/h3-7H,1H2,2H3
InChI key:InChIKey=NUMHUJZXKZKUBN-UHFFFAOYSA-N
SMILES:C=Cc1ccc(C(=O)OC)cc1