Informazioni sul prodotto
Nome:o-Methylbenzylamine
Marchio:Biosynth
Descrizione:o-Methylbenzylamine is a primary amine that has the chemical formula CH3C6H4NH2. It is an argon-type isomeric molecule with a phenyl group and biphenyl cavity. The molecule possesses pseudoephedrine and chiral properties. o-Methylbenzylamine has been found to be a useful substrate for chemical ionization mass spectrometry (CIMS) due to its molecular weight, molecular structure, and stability.
Amines are compounds that contain both nitrogen and hydrogen atoms in their molecules. They can be classified as primary or secondary amines depending on whether the nitrogen atom is part of the aromatic ring or not. Primary amines react with nitrous acid (HNO2) to form nitrosoamines, which are carcinogenic in nature; however, secondary amines do not react with nitrous acid because they lack an aromatic ring.
Amines are compounds that contain both nitrogen and hydrogen atoms in their molecules. They can be classified as primary or secondary amines depending on whether the nitrogen atom is part of the aromatic ring or not. Primary amines react with nitrous acid (HNO2) to form nitrosoamines, which are carcinogenic in nature; however, secondary amines do not react with nitrous acid because they lack an aromatic ring.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:121.18 g/mol
Formula:C8H11N
Purezza:Min. 95%
Colore/Forma:Clear Liquid
InChI:InChI=1S/C8H11N/c1-7-4-2-3-5-8(7)6-9/h2-5H,6,9H2,1H3
InChI key:InChIKey=CJAAPVQEZPAQNI-UHFFFAOYSA-N
SMILES:Cc1ccccc1CN