Informazioni sul prodotto
Nome:Oxalyl dihydrazide
Marchio:Biosynth
Descrizione:Oxalyl dihydrazide is a chemical compound that contains the cyanuric acid group. It is a white, crystalline solid that is soluble in water and alcohols. Oxalyl dihydrazide has antimicrobial activity and can be used as an additive to disinfect drinking water. In addition, oxalyl dihydrazide has been shown to inhibit the growth of bacteria by interfering with their ability to produce ATP. The mechanism of action involves oxidation of the hydroxyl group on the alpha carbon atom in the molecule and subsequent formation of an intramolecular hydrogen bond with another hydroxy group on a different molecule. This inhibits ATP production by binding to the oxygen atoms in ATP, which are needed for energy production reactions.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:118.09 g/mol
Formula:C2H6N4O2
Purezza:Min. 95%
InChI:InChI=1S/C2H6N4O2/c3-5-1(7)2(8)6-4/h3-4H2,(H,5,7)(H,6,8)
InChI key:InChIKey=SWRGUMCEJHQWEE-UHFFFAOYSA-N
SMILES:NNC(=O)C(=O)NN