Informazioni sul prodotto
Nome:1-Propylbutylamine
Sinonimi:
- 4-Aminoheptane
Marchio:Biosynth
Descrizione:1-Propylbutylamine is an organic compound that is used as a reagent in the synthesis of other compounds. It can be used in analytical toxicology to determine the presence of drugs. 1-Propylbutylamine is an isomer of n-butyl amine, but has a different molecular structure. The intramolecular hydrogen bonds are formed between the nitrogen atoms and the carbonyl group on the adjacent carbon atom. The photophysical properties and chemical reactivity of 1-propylbutylamine depend on its structural features. It reacts with chloride ions to form hydrochloric acid, and undergoes amination reactions with methyl ketones to form substituted amines. This compound may also be used in the manufacture of recycled plastics because it contains chlorine, which can be removed by burning off excess hydrogen chloride gas. 1-Propylbutylamine also has pressor effects due to its ability to release nitric oxide from endothelial cells,
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:115.22 g/mol
Formula:C7H17N
Purezza:Min. 95%
InChI:InChI=1S/C7H17N/c1-3-5-7(8)6-4-2/h7H,3-6,8H2,1-2H3
InChI key:InChIKey=CLJMMQGDJNYDER-UHFFFAOYSA-N
SMILES:CCCC(N)CCC