

Informazioni sul prodotto
Nome:Picene (purified by sublimation)
Sinonimi:
- Benzo[a]chrysene (purified by sublimation)
Marchio:Biosynth
Descrizione:Picene is a chemical compound that has been purified by sublimation. It has a molecular weight of 116.07 and a UV absorption maximum at 230 nm, which is the wavelength of light used to measure its concentration in the atmosphere. Picene is also soluble in most organic solvents and reacts with oxygen to form picene oxide, which is insoluble. The molecule consists of three benzene rings linked together by methoxy groups. Picene can undergo oxidation reactions, such as the conversion of chlorine atoms to chloride ions or the formation of reaction intermediates like chloromethyl groups through nucleophilic substitution reactions. Picene is chemically stable and does not react with strong acids or bases.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:278.35 g/mol
Formula:C22H14
Purezza:Min. 95%
InChI:InChI=1S/C22H14/c1-3-7-17-15(5-1)9-11-21-19(17)13-14-20-18-8-4-2-6-16(18)10-12-22(20)21/h1-14H
InChI key:InChIKey=GBROPGWFBFCKAG-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)ccc1c2ccc2c3ccccc3ccc21