Informazioni sul prodotto
Nome:Quinolinium Dichromate
Marchio:Biosynth
Descrizione:Quinolinium dichromate is a complex ionic compound that is formed by the reaction of picolinic acid and potassium dichromate. It is a redox catalyst, meaning it can be used to oxidize or reduce other compounds, as well as catalyzing organic reactions. Quinolinium dichromate also has some cationic surfactant properties, which allow it to act as a non-ionic surfactant in water at high concentrations. The mechanism for this surfactant activity is not fully understood, but may involve transfer reactions between the quinolinium chromophore and hydrophilic groups on the surface of the molecule.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:476.32 g/mol
Formula:C18H16Cr2N2O7
Purezza:Min. 95%
InChI:InChI=1S/2C9H7N.2Cr.2H2O.5O/c2*1-2-6-9-8(4-1)5-3-7-10-9;;;;;;;;;/h2*1-7H;;;2*1H2;;;;;/q;;2*+1;;;;;;;/p-2
InChI key:InChIKey=VYAXDENVDDHTOH-UHFFFAOYSA-L
SMILES:O=[Cr](=O)(O)O[Cr](=O)(=O)O.c1ccc2ncccc2c1.c1ccc2ncccc2c1