Informazioni sul prodotto
Nome:Triethylborane - 1M in THF
Marchio:Biosynth
Descrizione:Triethylborane (TEB) is a compound that is used as an oxidant in organic synthesis. It is also used for the synthesis of other compounds, such as epoxides, asymmetric syntheses, and hydroxylation reactions. TEB has been shown to be highly resistant to repair mechanisms. The nitrogen atoms are present in a form of triethylamine borane or triethylamine borane-1M in THF. This compound can be used to study both infectious diseases and biological processes. TEB reacts with malonic acid to produce boric acid and epoxides. The reaction mechanism involves an acid complex that forms between the carboxylic acid and the hydroxyl group on the TEB molecule.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:97.99 g/mol
Formula:C6H15B
Purezza:Min. 95%
InChI:InChI=1S/C6H15B/c1-4-7(5-2)6-3/h4-6H2,1-3H3
InChI key:InChIKey=LALRXNPLTWZJIJ-UHFFFAOYSA-N
SMILES:CCB(CC)CC