Informazioni sul prodotto
Nome:tert-Butyl crotonate
Marchio:Biosynth
Descrizione:Tert-Butyl crotonate is a synthetic compound that is used in organic synthesis. It can be prepared by the elimination of carbon dioxide from crotonic acid with sodium carbonate, which produces tert-butyl crotonate and sodium bicarbonate. Tert-Butyl crotonate can also be obtained from naphthalene through anhydrous sodium chlorite or hydrochloric acid. The chemical reactions are summarized in the following scheme:
The tert-butyl group has an asymmetric center, so there are two possible enolate forms. The enolate form on the right is more stable because it has less steric hindrance from the tert-butyl group. This means that it will react faster with carbonyl compounds to give products with higher yields.
The tert-butyl group has an asymmetric center, so there are two possible enolate forms. The enolate form on the right is more stable because it has less steric hindrance from the tert-butyl group. This means that it will react faster with carbonyl compounds to give products with higher yields.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:142.2 g/mol
Formula:C8H14O2
Purezza:Min. 95%
InChI:InChI=1S/C8H14O2/c1-5-6-7(9)10-8(2,3)4/h5-6H,1-4H3/b6-5+
InChI key:InChIKey=QHSPZGZEUDEIQM-AATRIKPKSA-N
SMILES:C/C=C/C(=O)OC(C)(C)C