

Informazioni sul prodotto
Nome:Trinonylamine
Marchio:Biosynth
Descrizione:Trinonylamine is an aromatic hydrocarbon that is used in the production of dyes and pigments. It has been shown to undergo a reaction with hydrochloric acid and hydrogen fluoride to produce trinitroaniline, which is then oxidized to form aniline. This reaction can be used in the production of nitrocellulose, a solid material that is sensitive to light exposure. Trinonylamine is immiscible with solvents such as water and alcohols due to its high molecular weight. It also has a patterning effect on fatty acids. Trinonylamine reacts with hydroxyl groups, forming an amide group, which can then react with carbonyl groups or aliphatic hydrocarbons to form amines.
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:395.75 g/mol
Formula:C27H57N
Purezza:Min. 95%
InChI:InChI=1S/C27H57N/c1-4-7-10-13-16-19-22-25-28(26-23-20-17-14-11-8-5-2)27-24-21-18-15-12-9-6-3/h4-27H2,1-3H3
InChI key:InChIKey=ZQJAONQEOXOVNR-UHFFFAOYSA-N
SMILES:CCCCCCCCCN(CCCCCCCCC)CCCCCCCCC