Informazioni sul prodotto
Nome:Triphenyl borate
Sinonimi:
- Boric acid triphenyl esterPhenyl borateBoron triphenoxide
Marchio:Biosynth
Descrizione:Triphenyl borate is a white solid with a melting point of −35.8°C. It has the chemical formula C6H5BO3 and is synthesized from ethyl diazoacetate, aziridine, and diphenyl sulfoxide. Triphenyl borate can be used as a catalyst for aziridination reactions and for the production of polyurethanes. It also functions as an intermediate in the synthesis of various amines, such as methylamine, ethylamine, and diethylamine. The viscosity of triphenyl borate solutions increases with concentration due to hydrogen bonding between molecules. Triphenyl borate can be used to dissolve hydrochloric acid by reacting with it in solution to form HCl gas and triphenyl borate hydrochloride salt (C6H5BO3·HCl). Triphenyl borate is also used in magnetic resonance spectroscopy because it emits light
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:290.12 g/mol
Formula:C18H15BO3
Purezza:Min. 95%
InChI:InChI=1S/C18H15BO3/c1-4-10-16(11-5-1)20-19(21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18/h1-15H
InChI key:InChIKey=MDCWDBMBZLORER-UHFFFAOYSA-N
SMILES:c1ccc(OB(Oc2ccccc2)Oc2ccccc2)cc1