Informazioni sul prodotto
Nome:1,2,3,4Tetrahydroquinoline
Marchio:Biosynth
Descrizione:1,2,3,4Tetrahydroquinoline is a chemical compound that has been used in the synthesis of various drugs. It is an aromatic compound with a six-membered ring, which reacts with an aryl halide to form a heterocycle. 1,2,3,4Tetrahydroquinoline has shown anti-inflammatory properties and has been used as a treatment for various allergic reactions. Studies have also shown that this chemical may be effective in the treatment of cancer and autoimmune diseases. 1,2,3,4Tetrahydroquinoline is also found in myeloid leukemia cells and redox potential can be used to differentiate between different cell types. This molecule can form ternary complexes with hydrogen bond donors such as trifluoroacetic acid and hydrogen bond acceptors such as nitrogen atoms or cholesterol esters. 1,2 3 4 Tetrahydroquinoline is also known to inhibit hematop
Avviso:I nostri prodotti sono destinati esclusivamente ad uso di laboratorio. Per qualsiasi altro utilizzo, vi preghiamo di contattarci.
Proprietà chimiche
Peso molecolare:133.19 g/mol
Formula:C9H11N
Purezza:Min. 95%
InChI:InChI=1S/C9H11N/c1-2-6-9-8(4-1)5-3-7-10-9/h1-2,4,6,10H,3,5,7H2
InChI key:InChIKey=LBUJPTNKIBCYBY-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)CCCN2