CAS 1006493-81-7

Formel: C8H12N2O2

InChl: InChI=1S/C8H12N2O2/c1-2-3-6-10-7(8(11)12)4-5-9-10/h4-5H,2-3,6H2,1H3,(H,11,12)

InChI Key: GPCNIDIHJOJQFF-UHFFFAOYSA-N

SMILES: CCCCN1C(=CC=N1)C(=O)O

1-Butyl-1H-pyrazole-5-carboxylic acid

CAS: 1006493-81-7

1-Butyl-1H-pyrazole-5-carboxylic acid is an inhibitor that can inhibit the growth of microorganisms in wastewater, and it has been shown to be effective against resistant microorganisms such as β-lactamase producing bacteria. It also inhibits the production of chlorophyll a., which is essential for photosynthesis. The optical properties of 1-butyl-1H-pyrazole -5-carboxylic acid are similar to those of c1-6 alkyl (C1 to C6), which means that it can be used as a solvent or fuel additive. 1BPCA also has antiinflammatory properties, and has been shown to reduce ischemia/reperfusion injury in mice.

Formel: C₈H₁₂N₂O₂

Reinheit: Min. 95%

Molekulargewicht: 168.19 g/mol

Ref: 3D-GQB49381