CAS 100665-44-9

Formel: C30H40O8

InChl: InChI=1S/C30H40O8/c1-14(10-16(31)11-15(2)26(37)38)17-12-21(34)30(7)22-18(32)13-19-27(3,4)20(33)8-9-28(19,5)23(22)24(35)25(36)29(17,30)6/h14-15,17,19,25,36H,8-13H2,1-7H3,(H,37,38)

InChI Key: MNXGGTWKTCLFDT-UHFFFAOYSA-N

SMILES: CC(CC(=O)CC(C)C(=O)O)C1CC(=O)C2(C1(C(C(=O)C3=C2C(=O)CC4C3(CCC(=O)C4(C)C)C)O)C)C

Deacetyl ganoderic acid F

CAS: 100665-44-9

Deacetyl ganoderic acid F (DeGA F), a triterpenoid extracted from Ganoderma lucidum, inhibits lipopolysaccharide (LPS)-induced inflammation in vitro and in vivo

Formel: C₃₀H₄₀O₈

Reinheit: 98.40%

Farbe und Form: Solid

Molekulargewicht: 528.6338

Ref: TM-TN1553

Deacetyl ganoderic acid F

CAS: 100665-44-9

Deacetyl ganoderic acid F

Formel: C₃₀H₄₀O₈

Reinheit: 98%

Molekulargewicht: 528.642

Ref: 54-BUP00497

Deacetyl ganoderic acid F

CAS: 100665-44-9

Formel: C₃₀H₄₀O₈

Molekulargewicht: 528.64

Ref: 7W-GY6367

Deacetyl ganoderic acid F

CAS: 100665-44-9

Formel: C₃₀H₄₀O₈

Reinheit: 95%~99%

Farbe und Form: Powder

Molekulargewicht: 528.642

Ref: BP-BP3108

Deacetyl ganoderic acid F

CAS: 100665-44-9

Formel: C₃₀H₄₀O₈

Reinheit: 98%

Molekulargewicht: 528.6338

Ref: IN-DA008Y34

Deacetyl ganoderic acid F

Kontrolliertes Produkt

CAS: 100665-44-9

Deacetyl ganoderic acid F is a triterpenoid compound, specifically derived from the fungal species Ganoderma lucidum, also known as Reishi mushroom. This compound is part of a class of bioactive molecules known as ganoderic acids, which are secondary metabolites produced by the mushroom. It exhibits its mode of action primarily through modulation of various biological pathways, including anti-inflammatory, antioxidant, and immunomodulatory effects.

Formel: C₃₀H₄₀O₈

Reinheit: Min. 95%

Molekulargewicht: 528.64 g/mol

Ref: 3D-AEA66544