CAS 1017059-08-3

Formel: C15H10O7

InChl: InChI=1S/C15H10O7/c16-6-1-2-12-8(3-6)13(20)14(21)15(22-12)7-4-10(18)11(19)5-9(7)17/h1-5,16-19,21H

InChI Key: RVFIXKXGOWFZDL-UHFFFAOYSA-N

SMILES: C1=CC2=C(C=C1O)C(=O)C(=C(O2)C3=CC(=C(C=C3O)O)O)O

3,2',4',5',6-Pentahydroxyflavone

CAS: 1017059-08-3

3,2',4',5',6-Pentahydroxyflavone is a flavonoid compound, often studied for its intricate chemical properties. It is derived from various plant sources, where it occurs naturally as a secondary metabolite. As a flavonoid, it is notable for its polyphenolic structure, contributing to its role as an antioxidant. The mode of action involves neutralizing free radicals and chelating metal ions, thereby reducing oxidative stress within biological systems.

Formel: C₁₅H₁₀O₇

Reinheit: Min. 95%

Farbe und Form: Powder

Molekulargewicht: 302.24 g/mol

Ref: 3D-XP182991