CAS 1060802-18-7

Formel: C5H3Cl2NO2S

InChl: InChI=1S/C5H3Cl2NO2S/c6-4-1-5(3-8-2-4)11(7,9)10/h1-3H

InChI Key: FQNDXOOGXYFWHZ-UHFFFAOYSA-N

SMILES: C1=C(C=NC=C1Cl)S(=O)(=O)Cl

5-Chloro-3-pyridinesulfonyl chloride

CAS: 1060802-18-7

Formel: C₅H₃Cl₂NO₂S

Reinheit: 95%

Farbe und Form: Solid

Molekulargewicht: 212.0538

Ref: IN-DA008UCX

5-Chloropyridine-3-sulfonyl chloride

CAS: 1060802-18-7

5-Chloropyridine-3-sulfonyl chloride

Reinheit: 97%

Molekulargewicht: 212.05g/mol

Ref: 54-OR1035158

Vonoprazan Impurity 22

CAS: 1060802-18-7

Formel: C₅H₃Cl₂NO₂S

Molekulargewicht: 212.06

Ref: 4Z-V-051024

5-Chloropyridine-3-sulfonyl chloride

CAS: 1060802-18-7

5-Chloropyridine-3-sulfonyl chloride

Formel: C₅H₃Cl₂NO₂S

Reinheit: 95%

Molekulargewicht: 212.05

Ref: IN-DG221766

5-Chloropyridine-3-sulfonyl chloride

CAS: 1060802-18-7

Reinheit: 97%

Molekulargewicht: 212.0399933

Ref: 10-F614149

5-Chloro-3-pyridinesulfonyl Chloride

Kontrolliertes Produkt

CAS: 1060802-18-7

Formel: C₅H₃Cl₂NO₂S

Farbe und Form: Neat

Ref: TR-C380830

5-Chloro-3-pyridinesulfonyl Chloride

CAS: 1060802-18-7

5-Chloro-3-pyridinesulfonyl Chloride is a colorless liquid with a strong odor. It is soluble in water and hydrochloric acid, but not in alcohol. The product is used as an intermediate for the synthesis of other organic compounds. 5-Chloro-3-pyridinesulfonyl Chloride can be reacted with various chemicals to produce many different types of products, such as pharmaceuticals, pesticides, or dyes.

Formel: C₅H₃Cl₂NO₂S

Reinheit: Min. 95%

Molekulargewicht: 212.05 g/mol

Ref: 3D-KSB80218

Vonoprazan Impurity 110

CAS: 1060802-18-7

Formel: C₅H₃Cl₂NO₂S

Molekulargewicht: 212.04

Ref: ST-EA-CP-V14072