CAS 1134138-66-1

Formel: C32H50O13

InChl: InChI=1S/C32H50O13/c1-17(2)10-24(34)42-16-32(39)23(43-21(9)33)13-31(38)22(15-41-30(28(31)32)45-26(36)12-19(5)6)14-40-29(37)27(20(7)8)44-25(35)11-18(3)4/h15,17-20,23,27-28,30,38-39H,10-14,16H2,1-9H3/t23-,27?,28-,30-,31-,32+/m0/s1

InChI Key: ZWCCPUWSKJGJNH-ZTJXRXMQSA-N

SMILES: CC(C)CC(=O)OC[C@]1([C@H](C[C@]2([C@@H]1[C@@H](OC=C2COC(=O)C(C(C)C)OC(=O)CC(C)C)OC(=O)CC(C)C)O)OC(=O)C)O

Jatamanvaltrate B

CAS: 1134138-66-1

Jatamanvaltrate B is cytotoxic to A549, PC-3M, HCT-8, and Bel7402 cancer cells.

Formel: C₃₂H₅₀O₁₃

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 642.73

Ref: TM-TN4352

Jatamanvaltrate B

CAS: 1134138-66-1

Formel: C₃₂H₅₀O₁₃

Reinheit: 95%~99%

Molekulargewicht: 642.739

Ref: BP-SBP03644

Jatamanvaltrate B

CAS: 1134138-66-1

Jatamanvaltrate B is a sesquiterpene ester, which is isolated from the roots of the plant Valeriana jatamansi. This species is commonly found in Asian regions and is part of the Valerianaceae family. The compound is primarily characterized by its structural composition, which includes valerian-derived terpenoids known for their complex chemical architectures.

Formel: C₃₂H₅₀O₁₃

Reinheit: Min. 95%

Molekulargewicht: 642.7 g/mol

Ref: 3D-JVB13866