CAS 115356-18-8

Formel: C15H22O2

InChl: InChI=1S/C15H22O2/c1-10-6-5-7-11-12(16)8-9-13(14(2,3)17)15(10,11)4/h7-10,13,17H,5-6H2,1-4H3/t10-,13+,15+/m1/s1

InChI Key: CSSWGHXLDCLRSF-DGFSRKRXSA-N

SMILES: C[C@@H]1CCC=C2[C@]1([C@@H](C=CC2=O)C(C)(C)O)C

Kanshone A

CAS: 115356-18-8

Kanshone A

Formel: C₁₅H₂₂O₂

Reinheit: ≥98%

Molekulargewicht: 234.33

Ref: 54-OR1108146

Kanshone A

CAS: 115356-18-8

Kanshone A, a sesquiterpenoid naturally derived from Nardostachys chinensis, is cytotoxic and inhibits the proliferation of P-388 leukemia cells.

Formel: C₁₅H₂₂O₂

Reinheit: 98%

Farbe und Form: Solid

Molekulargewicht: 234.334

Ref: TM-TN4376

Kanshone A

CAS: 115356-18-8

Formel: C₁₅H₂₂O₂

Reinheit: 95%~99%

Molekulargewicht: 234.339

Ref: BP-BP5707

Kanshone A

CAS: 115356-18-8

Formel: C₁₅H₂₂O₂

Reinheit: 98%

Molekulargewicht: 234.334

Ref: IN-DA01V2VD

Kanshone A

CAS: 115356-18-8

Kanshone A is a synthetic small molecule, which is derived from laboratory-designed chemical synthesis pathways. This compound is engineered to specifically modulate transcriptional activity by acting as an epigenetic modulator. Its mode of action primarily involves binding to chromatin-associated proteins, thereby influencing the accessibility of transcriptional machinery to genomic DNA. By altering the interaction between histones and DNA, Kanshone A can effectively induce or repress the expression of target genes.

Formel: C₁₅H₂₂O₂

Reinheit: Min. 95%

Molekulargewicht: 234.33 g/mol

Ref: 3D-QEA35618