CAS 1398109-09-5

Formel: C17H14N2O2

InChl: InChI=1S/C17H14N2O2/c1-21-16-9-5-4-8-14(16)18-19-17-13-7-3-2-6-12(13)10-11-15(17)20/h2-11,20H,1H3/i1D3

InChI Key: ALLOLPOYFRLCCX-FIBGUPNXSA-N

SMILES: [2H]C([2H])([2H])OC1=CC=CC=C1N=NC2=C(C=CC3=CC=CC=C32)O

1-(2-Methoxy-d3-phenylazo)-2-naphthol

CAS: 1229-55-6, 1398109-09-5

Reinheit: 99 atom % D

Farbe und Form: Red-Brown Solid

Molekulargewicht: 281.33

Ref: 3U-D7361

Sudan R- d3

CAS: 1398109-09-5

Sudan R-d3 is a medicinal compound that acts as a kinase inhibitor, targeting kinases involved in cancer cell growth and proliferation. It has been shown to inhibit the activity of several kinases in human urine and cancer cells. Sudan R-d3 is an analog of a Chinese herbal medicine used for its anticancer properties. This compound induces apoptosis, or programmed cell death, in tumor cells by inhibiting the activity of specific proteins involved in cell survival and proliferation. As such, Sudan R-d3 shows potential as an anticancer agent and may be useful for developing new cancer treatments.

Formel: C₁₇H₁₄N₂O₂

Reinheit: Min. 95%

Molekulargewicht: 281.32 g/mol

Ref: 3D-YFC10909