CAS 1469925-36-7

Formel: C23H23ClF3N5O2

InChl: InChI=1S/C23H22F3N5O2.ClH/c1-12-10-31(11-16(27)22(12)32)19-7-8-28-9-18(19)30-23(33)17-6-5-15(26)21(29-17)20-13(24)3-2-4-14(20)25;/h2-9,12,16,22,32H,10-11,27H2,1H3,(H,30,33);1H

InChI Key: AYJXIKQJCYKKTJ-UHFFFAOYSA-N

SMILES: CC1CN(CC(C1O)N)C2=C(C=NC=C2)NC(=O)C3=NC(=C(C=C3)F)C4=C(C=CC=C4F)F.Cl

LGB-321 HCl

CAS: 1469925-36-7

LGB-321 HCl is a serotonergic receptor modulator, which is synthesized from artificial chemical precursors. Its mechanism of action involves the selective modulation of specific serotonin receptors, potentially altering neurotransmitter pathways associated with various psychiatric and neurological disorders. The modulation of these pathways is critical in understanding the role of serotonin in mood, anxiety, and cognitive functions.

Formel: C₂₃H₂₃ClF₃N₅O₂

Reinheit: Min. 95%

Molekulargewicht: 493.9 g/mol

Ref: 3D-UIC92536

LGB321 monohydrochloride

CAS: 1469925-36-7

LGB321 monohydrochloride is an effective, selective, and orally active ATP-competitive small molecule inhibitor that targets all three PIM kinases. It inhibits proliferation, the mTOR-C1 signaling pathway, and BAD phosphorylation in various blood cancer-derived cell lines. LGB321 monohydrochloride is suitable for research on hematological malignancies.

Formel: C₂₃H₂₃ClF₃N₅O₂

Molekulargewicht: 493.91

Ref: TM-T208966